Products 2200876-67-9
CAS 2200876-67-9 is the registry number for 5-Cyclopropyl-1-methyl-1h-pyrazole-3-carbohydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
5-cyclopropyl-1-methylpyrazole-3-carbohydrazide (CAS 2200876-67-9) is a chemical compound with the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. IUPAC name: 5-cyclopropyl-1-methylpyrazole-3-carbohydrazide. InChIKey: ZTWVZBVRKFAJRC-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O |
|---|---|
| Molecular weight | 180.21 g/mol |
| IUPAC name | 5-cyclopropyl-1-methylpyrazole-3-carbohydrazide |
| InChIKey | ZTWVZBVRKFAJRC-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)NN)C2CC2 |
Computed by PubChem (NCBI)