CAS 220088-40-4 appears in our catalog under these names: Metanicotine-d3, Rivanicline-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
(E)-4-pyridin-3-yl-N-(trideuteriomethyl)but-3-en-1-amine (CAS 220088-40-4) is a chemical compound with the molecular formula C10H14N2 and a molecular weight of 165.25 g/mol. IUPAC name: (E)-4-pyridin-3-yl-N-(trideuteriomethyl)but-3-en-1-amine. InChIKey: JUOSGGQXEBBCJB-PAMUQJMYSA-N.
| Molecular formula | C10H14N2 |
|---|---|
| Molecular weight | 165.25 g/mol |
| IUPAC name | (E)-4-pyridin-3-yl-N-(trideuteriomethyl)but-3-en-1-amine |
| InChIKey | JUOSGGQXEBBCJB-PAMUQJMYSA-N |
| SMILES | [2H]C([2H])([2H])NCC/C=C/C1=CN=CC=C1 |
Computed by PubChem (NCBI)