Products 220100-05-0
CAS 220100-05-0 appears in our catalog under these names: α7 Nicotinic receptor agonist–1, α7 Nicotinic receptor agonist-1, 99.70%, α7 Nicotinic receptor agonist-1, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 5 mg, 10mM/1mL, 100 mg, 25 mg, 10 mg.
(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-amine (CAS 220100-05-0) is a chemical compound with the molecular formula C13H17N3O and a molecular weight of 231.29 g/mol. IUPAC name: (3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-amine. InChIKey: SWFYVZKNABTMPR-ZDUSSCGKSA-N.
| Molecular formula | C13H17N3O |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-amine |
| InChIKey | SWFYVZKNABTMPR-ZDUSSCGKSA-N |
| SMILES | C1CN2CCC1[C@@]3(C2)CC4=C(O3)N=CC(=C4)N |
Computed by PubChem (NCBI)