Products 2201066-53-5
CAS 2201066-53-5 appears in our catalog under these names: AGI–24512, AGI-24512/ 98.55% (existing batch purity), AGI 24512, AGI 24512, 99%, 99%, AGI-24512, 99.72%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
6-(4-hydroxyphenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 2201066-53-5) is a chemical compound with the molecular formula C24H24N4O2 and a molecular weight of 400.5 g/mol. IUPAC name: 6-(4-hydroxyphenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: VFEXODVWKUOZBF-UHFFFAOYSA-N.
| Molecular formula | C24H24N4O2 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 6-(4-hydroxyphenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | VFEXODVWKUOZBF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)C(=C(N2)C3=CC=CC=C3)N4CCCCC4)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)
Synonyms:
orb1218426, orb1707707