CAS 22020-64-0 appears in our catalog under these names: 3-Phenyl-5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]-1,2,4-oxadiazole, 95%, 1,2-Bis(3-phenyl-1,2,4-oxadiazol-5-yl)ethane, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-phenyl-5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]-1,2,4-oxadiazole (CAS 22020-64-0) is a chemical compound with the molecular formula C18H14N4O2 and a molecular weight of 318.3 g/mol. IUPAC name: 3-phenyl-5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]-1,2,4-oxadiazole. InChIKey: KECUONFFPPDLHK-UHFFFAOYSA-N.
| Molecular formula | C18H14N4O2 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 3-phenyl-5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]-1,2,4-oxadiazole |
| InChIKey | KECUONFFPPDLHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)CCC3=NC(=NO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)