CAS 22026-37-5 appears in our catalog under these names: 2,3-Butanedione-d6 (Major), 2,3-Butanedione-d6, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 10mg, 1g, 0,5g.
1,1,1,4,4,4-hexadeuteriobutane-2,3-dione (CAS 22026-37-5) is a chemical compound with the molecular formula C4H6O2 and a molecular weight of 92.13 g/mol. IUPAC name: 1,1,1,4,4,4-hexadeuteriobutane-2,3-dione. InChIKey: QSJXEFYPDANLFS-WFGJKAKNSA-N.
| Molecular formula | C4H6O2 |
|---|---|
| Molecular weight | 92.13 g/mol |
| IUPAC name | 1,1,1,4,4,4-hexadeuteriobutane-2,3-dione |
| InChIKey | QSJXEFYPDANLFS-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C(=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)