Products 22026-63-7

CAS 22026-63-7 appears in our catalog under these names: S-Butyrylthiocholine chloride, 95%, 2-Butanoylsulfanylethyl(trimethyl)azanium Chloride, >95% (HPLC), S-Butyrylthiocholine chloride, 97%, S–Butyrylthiocholine (chloride), Butyrylthiocholine chloride, 97.00%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg.

Structural formula: {0} (CAS {1})

2-butanoylsulfanylethyl(trimethyl)azanium chloride (CAS 22026-63-7) is a chemical compound with the molecular formula C9H20ClNOS and a molecular weight of 225.78 g/mol. IUPAC name: 2-butanoylsulfanylethyl(trimethyl)azanium chloride. InChIKey: QYNZLUZQWOCGCH-UHFFFAOYSA-M.

Identity
Molecular formulaC9H20ClNOS
Molecular weight225.78 g/mol
IUPAC name2-butanoylsulfanylethyl(trimethyl)azanium chloride
InChIKeyQYNZLUZQWOCGCH-UHFFFAOYSA-M
SMILESCCCC(=O)SCC[N+](C)(C)C.[Cl-]

Computed by PubChem (NCBI)