Products 2202731-16-4
CAS 2202731-16-4 is the registry number for rac-((1R,5R,6R)-3-Azabicyclo(3.2.0)heptan-6-yl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(1R,5R,6R)-3-azabicyclo[3.2.0]heptan-6-yl]methanol;hydrochloride (CAS 2202731-16-4) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: [(1R,5R,6R)-3-azabicyclo[3.2.0]heptan-6-yl]methanol;hydrochloride. InChIKey: IGLYYXORKQCAHX-LBZPYWGZSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | [(1R,5R,6R)-3-azabicyclo[3.2.0]heptan-6-yl]methanol;hydrochloride |
| InChIKey | IGLYYXORKQCAHX-LBZPYWGZSA-N |
| SMILES | C1[C@H]2CNC[C@H]2[C@@H]1CO.Cl |
Computed by PubChem (NCBI)