CAS 22031-53-4 is the registry number for rel-(1S,6R)-7-Azabicyclo(4.2.0)octan-8-one, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(1S,6R)-7-azabicyclo[4.2.0]octan-8-one (CAS 22031-53-4) is a chemical compound with the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. IUPAC name: (1S,6R)-7-azabicyclo[4.2.0]octan-8-one. InChIKey: SQHJLZVUXVHXKC-NTSWFWBYSA-N.
| Molecular formula | C7H11NO |
|---|---|
| Molecular weight | 125.17 g/mol |
| IUPAC name | (1S,6R)-7-azabicyclo[4.2.0]octan-8-one |
| InChIKey | SQHJLZVUXVHXKC-NTSWFWBYSA-N |
| SMILES | C1CC[C@@H]2[C@H](C1)C(=O)N2 |
Computed by PubChem (NCBI)