Products 2203194-87-8

CAS 2203194-87-8 is the registry number for Trans (4-[(cyclopropylmethyl-amino)-methyl]-cyclohexyl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[4-[(cyclopropylmethylamino)methyl]cyclohexyl]carbamate (CAS 2203194-87-8) is a chemical compound with the molecular formula C16H30N2O2 and a molecular weight of 282.42 g/mol. IUPAC name: tert-butyl N-[4-[(cyclopropylmethylamino)methyl]cyclohexyl]carbamate. InChIKey: HKHTWCJDTIFDLX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H30N2O2
Molecular weight282.42 g/mol
IUPAC nametert-butyl N-[4-[(cyclopropylmethylamino)methyl]cyclohexyl]carbamate
InChIKeyHKHTWCJDTIFDLX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCC(CC1)CNCC2CC2

Computed by PubChem (NCBI)