Products 2203403-97-6

CAS 2203403-97-6 is the registry number for (R)-2-(Pyrrolidin-3-yl)propan-2-ol hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(3R)-pyrrolidin-3-yl]propan-2-ol;hydrochloride (CAS 2203403-97-6) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: 2-[(3R)-pyrrolidin-3-yl]propan-2-ol;hydrochloride. InChIKey: CLMRAZFIFLFGKM-FYZOBXCZSA-N.

Identity
Molecular formulaC7H16ClNO
Molecular weight165.66 g/mol
IUPAC name2-[(3R)-pyrrolidin-3-yl]propan-2-ol;hydrochloride
InChIKeyCLMRAZFIFLFGKM-FYZOBXCZSA-N
SMILESCC(C)([C@@H]1CCNC1)O.Cl

Computed by PubChem (NCBI)