CAS 220355-66-8 is the registry number for Saxitoxin Diacetate Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Saxitoxin acetate is an acetate salt that is the diacetate of the toxic alkaloid saxitoxin. It contains a saxitoxin.
Source: ChEBI
| Molecular formula | C14H25N7O8 |
|---|---|
| Molecular weight | 419.39 g/mol |
| IUPAC name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate;acetic acid |
| InChIKey | ATZFJZKIYFVCKU-UIPPETONSA-N |
| SMILES | CC(=O)O.CC(=O)O.C1CN2C(=N[C@H]([C@H]3[C@]2(C1(O)O)NC(=N3)N)COC(=O)N)N |
Computed by PubChem (NCBI)