Products 2203714-65-0

CAS 2203714-65-0 is the registry number for 4-Amino-piperidine-1-carboxylic acid benzylamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-amino-N-benzylpiperidine-1-carboxamide;hydrochloride (CAS 2203714-65-0) is a chemical compound with the molecular formula C13H20ClN3O and a molecular weight of 269.77 g/mol. IUPAC name: 4-amino-N-benzylpiperidine-1-carboxamide;hydrochloride. InChIKey: NPBJXHIIPQROLC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20ClN3O
Molecular weight269.77 g/mol
IUPAC name4-amino-N-benzylpiperidine-1-carboxamide;hydrochloride
InChIKeyNPBJXHIIPQROLC-UHFFFAOYSA-N
SMILESC1CN(CCC1N)C(=O)NCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)