CAS 220400-04-4 appears in our catalog under these names: Cbz-Phe(4-I)-OH, 97%, 4-Iodo-N-[(phenylmethoxy)carbonyl]-L-phenylalanine, 97%, (S)-2-(((Benzyloxy)carbonyl)amino)-3-(4-iodophenyl)propanoic acid, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g.
(2S)-3-(4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 220400-04-4) is a chemical compound with the molecular formula C17H16INO4 and a molecular weight of 425.22 g/mol. IUPAC name: (2S)-3-(4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: RLQFURMICGBHLW-HNNXBMFYSA-N.
| Molecular formula | C17H16INO4 |
|---|---|
| Molecular weight | 425.22 g/mol |
| IUPAC name | (2S)-3-(4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | RLQFURMICGBHLW-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=C(C=C2)I)C(=O)O |
Computed by PubChem (NCBI)