Products 2204052-09-3

CAS 2204052-09-3 is the registry number for 5-Bromo-2-morpholin-4-yl-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-bromo-2-morpholin-4-ylpyridine-3-carboxylate (CAS 2204052-09-3) is a chemical compound with the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. IUPAC name: tert-butyl 5-bromo-2-morpholin-4-ylpyridine-3-carboxylate. InChIKey: UWDYJGLFEIRPQU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19BrN2O3
Molecular weight343.22 g/mol
IUPAC nametert-butyl 5-bromo-2-morpholin-4-ylpyridine-3-carboxylate
InChIKeyUWDYJGLFEIRPQU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(N=CC(=C1)Br)N2CCOCC2

Computed by PubChem (NCBI)