Products 2204229-64-9
CAS 2204229-64-9 appears in our catalog under these names: ALDH1A2-IN-1, ALDH1A2–IN–1, ALDH1A2-IN-1, 98.05%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 1mg, 10mg, 25mg, 10mM (in 1ml dmso), 50mg, 100mg.
(3-ethoxythiophen-2-yl)-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]methanone (CAS 2204229-64-9) is a chemical compound with the molecular formula C21H26N4O4S and a molecular weight of 430.5 g/mol. IUPAC name: (3-ethoxythiophen-2-yl)-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]methanone. InChIKey: LAYJOGOQGVGOCO-UHFFFAOYSA-N.
| Molecular formula | C21H26N4O4S |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (3-ethoxythiophen-2-yl)-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]methanone |
| InChIKey | LAYJOGOQGVGOCO-UHFFFAOYSA-N |
| SMILES | CCOC1=C(SC=C1)C(=O)N2CCN(CC2)C3=CC(=C(C=C3)[N+](=O)[O-])N4CCCC4 |
Computed by PubChem (NCBI)
Synonyms:
orb1691139, CQY