CAS 220478-98-8 appears in our catalog under these names: Oseltamivir Impurity 87, Oseltamivir Impurity 89. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4R,5S)-4-acetamido-3-acetyloxy-5-azidocyclohexene-1-carboxylate (CAS 220478-98-8) is a chemical compound with the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. IUPAC name: ethyl (3R,4R,5S)-4-acetamido-3-acetyloxy-5-azidocyclohexene-1-carboxylate. InChIKey: BWGPKPIQXWFJPG-QJPTWQEYSA-N.
| Molecular formula | C13H18N4O5 |
|---|---|
| Molecular weight | 310.31 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4-acetamido-3-acetyloxy-5-azidocyclohexene-1-carboxylate |
| InChIKey | BWGPKPIQXWFJPG-QJPTWQEYSA-N |
| SMILES | CCOC(=O)C1=C[C@H]([C@@H]([C@H](C1)N=[N+]=[N-])NC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)