CAS 220510-03-2 is the registry number for 5-(Morpholin-4-ylsulfonyl)-1h-indole-2,3-dione, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-morpholin-4-ylsulfonyl-1H-indole-2,3-dione (CAS 220510-03-2) is a chemical compound with the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. IUPAC name: 5-morpholin-4-ylsulfonyl-1H-indole-2,3-dione. InChIKey: AKGSTTAKYFDPMP-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5S |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | 5-morpholin-4-ylsulfonyl-1H-indole-2,3-dione |
| InChIKey | AKGSTTAKYFDPMP-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC3=C(C=C2)NC(=O)C3=O |
Computed by PubChem (NCBI)