CAS 220525-65-5 appears in our catalog under these names: 6(pyridin2yl)4(thiophen2yl)2,2'bipyridine, 98%, 98%, 4'-(2-Thienyl)-2,2':6',2''-terpyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
2,6-dipyridin-2-yl-4-thiophen-2-ylpyridine (CAS 220525-65-5) is a chemical compound with the molecular formula C19H13N3S and a molecular weight of 315.4 g/mol. IUPAC name: 2,6-dipyridin-2-yl-4-thiophen-2-ylpyridine. InChIKey: HFILQMLLLHVSOR-UHFFFAOYSA-N.
| Molecular formula | C19H13N3S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 2,6-dipyridin-2-yl-4-thiophen-2-ylpyridine |
| InChIKey | HFILQMLLLHVSOR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=CS4 |
Computed by PubChem (NCBI)