CAS 2205334-86-5 appears in our catalog under these names: tert-Butyl3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate oxalate, 95%, tert-Butyl3-amino-1-oxa-8-azaspiro(4.5)decane-8-carboxylate oxalate, 95%, tert–Butyl 3–amino–1–oxa–8–azaspiro(4·5)decane–8–carboxylate oxalat. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid (CAS 2205334-86-5) is a chemical compound with the molecular formula C15H26N2O7 and a molecular weight of 346.38 g/mol. IUPAC name: tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid. InChIKey: UJXSWBRYTLRKGV-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O7 |
|---|---|
| Molecular weight | 346.38 g/mol |
| IUPAC name | tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid |
| InChIKey | UJXSWBRYTLRKGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(CO2)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)