Products 220560-60-1

CAS 220560-60-1 is the registry number for (3-(Trimethylammonium)propyl) Methanethiosulfonate Bromide. Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Trimethyl(3-methylsulfonylsulfanylpropyl)azanium bromide (CAS 220560-60-1) is a chemical compound with the molecular formula C7H18BrNO2S2 and a molecular weight of 292.3 g/mol. IUPAC name: trimethyl(3-methylsulfonylsulfanylpropyl)azanium bromide. InChIKey: WJPFIZQKYFWENL-UHFFFAOYSA-M.

Identity
Molecular formulaC7H18BrNO2S2
Molecular weight292.3 g/mol
IUPAC nametrimethyl(3-methylsulfonylsulfanylpropyl)azanium bromide
InChIKeyWJPFIZQKYFWENL-UHFFFAOYSA-M
SMILESC[N+](C)(C)CCCSS(=O)(=O)C.[Br-]

Computed by PubChem (NCBI)