CAS 220560-60-1 is the registry number for (3-(Trimethylammonium)propyl) Methanethiosulfonate Bromide. Offered by: TRC. Available pack sizes: 100mg, 1g.
Trimethyl(3-methylsulfonylsulfanylpropyl)azanium bromide (CAS 220560-60-1) is a chemical compound with the molecular formula C7H18BrNO2S2 and a molecular weight of 292.3 g/mol. IUPAC name: trimethyl(3-methylsulfonylsulfanylpropyl)azanium bromide. InChIKey: WJPFIZQKYFWENL-UHFFFAOYSA-M.
| Molecular formula | C7H18BrNO2S2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | trimethyl(3-methylsulfonylsulfanylpropyl)azanium bromide |
| InChIKey | WJPFIZQKYFWENL-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCCSS(=O)(=O)C.[Br-] |
Computed by PubChem (NCBI)