CAS 2206-50-0 appears in our catalog under these names: 4-tert-Butylbenzene-1,3-diol, 95%, 4–tert–Butyl–resorcinol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
4-tert-butylbenzene-1,3-diol (CAS 2206-50-0) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 4-tert-butylbenzene-1,3-diol. InChIKey: YBKODUYVZRLSOK-UHFFFAOYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 4-tert-butylbenzene-1,3-diol |
| InChIKey | YBKODUYVZRLSOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)O)O |
Computed by PubChem (NCBI)