Products 220619-73-8
CAS 220619-73-8 appears in our catalog under these names: AGN 194204, iso IRX-A, AGN194204, AGN194204, 99.0%, 99.0%, AGN194204, 99.94%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 75mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg.
(2E,4E)-3-methyl-5-[(1S,2S)-2-methyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]penta-2,4-dienoic acid (CAS 220619-73-8) is a chemical compound with the molecular formula C24H32O2 and a molecular weight of 352.5 g/mol. IUPAC name: (2E,4E)-3-methyl-5-[(1S,2S)-2-methyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]penta-2,4-dienoic acid. InChIKey: BOOOLEGQBVUTKC-NVQSDHBMSA-N.
| Molecular formula | C24H32O2 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | (2E,4E)-3-methyl-5-[(1S,2S)-2-methyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]penta-2,4-dienoic acid |
| InChIKey | BOOOLEGQBVUTKC-NVQSDHBMSA-N |
| SMILES | C/C(=C\C(=O)O)/C=C/[C@@H]1C[C@]1(C)C2=CC3=C(C=C2)C(CCC3(C)C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
iso IRX-A, orb1707703