CAS 2206243-25-4 is the registry number for 1-((2,2-Difluorobenzo[d][1,3]dioxol-5-yl)methyl)piperazine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperazine;dihydrochloride (CAS 2206243-25-4) is a chemical compound with the molecular formula C12H16Cl2F2N2O2 and a molecular weight of 329.17 g/mol. IUPAC name: 1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperazine;dihydrochloride. InChIKey: CQRRRQCYIFBXQT-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2F2N2O2 |
|---|---|
| Molecular weight | 329.17 g/mol |
| IUPAC name | 1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperazine;dihydrochloride |
| InChIKey | CQRRRQCYIFBXQT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC3=C(C=C2)OC(O3)(F)F.Cl.Cl |
Computed by PubChem (NCBI)