CAS 2206608-22-0 is the registry number for 1-(3-Fluoro-2-isopropoxy-phenyl)-propylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-fluoro-2-propan-2-yloxyphenyl)propan-1-amine;hydrochloride (CAS 2206608-22-0) is a chemical compound with the molecular formula C12H19ClFNO and a molecular weight of 247.73 g/mol. IUPAC name: 1-(3-fluoro-2-propan-2-yloxyphenyl)propan-1-amine;hydrochloride. InChIKey: AZJCNBSMIRYEPA-UHFFFAOYSA-N.
| Molecular formula | C12H19ClFNO |
|---|---|
| Molecular weight | 247.73 g/mol |
| IUPAC name | 1-(3-fluoro-2-propan-2-yloxyphenyl)propan-1-amine;hydrochloride |
| InChIKey | AZJCNBSMIRYEPA-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C(=CC=C1)F)OC(C)C)N.Cl |
Computed by PubChem (NCBI)