Products 2206610-38-8

CAS 2206610-38-8 is the registry number for Toluene-4-sulfonic acid 2-[2-(2-iodo-ethoxy)-ethoxy]-ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-(2-iodoethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS 2206610-38-8) is a chemical compound with the molecular formula C13H19IO5S and a molecular weight of 414.26 g/mol. IUPAC name: 2-[2-(2-iodoethoxy)ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: MUNUTWBWOVFPOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19IO5S
Molecular weight414.26 g/mol
IUPAC name2-[2-(2-iodoethoxy)ethoxy]ethyl 4-methylbenzenesulfonate
InChIKeyMUNUTWBWOVFPOZ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCI

Computed by PubChem (NCBI)