Products 2206610-41-3

CAS 2206610-41-3 is the registry number for (2-[2-(Toluene-4-sulfonyloxy)-ethoxy]-ethoxy)-acetic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Benzyl 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetate (CAS 2206610-41-3) is a chemical compound with the molecular formula C20H24O7S and a molecular weight of 408.5 g/mol. IUPAC name: benzyl 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetate. InChIKey: UXFKORXYYYACLN-UHFFFAOYSA-N.

Identity
Molecular formulaC20H24O7S
Molecular weight408.5 g/mol
IUPAC namebenzyl 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetate
InChIKeyUXFKORXYYYACLN-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)