Products 2206737-56-4
CAS 2206737-56-4 is the registry number for tert-butyl (S)-5-(hydroxymethyl)-2,2-dimethylpyrrolidine-1-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (5S)-5-(hydroxymethyl)-2,2-dimethylpyrrolidine-1-carboxylate (CAS 2206737-56-4) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl (5S)-5-(hydroxymethyl)-2,2-dimethylpyrrolidine-1-carboxylate. InChIKey: PKMWPVLUYSIJNS-VIFPVBQESA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl (5S)-5-(hydroxymethyl)-2,2-dimethylpyrrolidine-1-carboxylate |
| InChIKey | PKMWPVLUYSIJNS-VIFPVBQESA-N |
| SMILES | CC1(CC[C@H](N1C(=O)OC(C)(C)C)CO)C |
Computed by PubChem (NCBI)