CAS 220677-29-2 is the registry number for Ethyl 1-(3,4-dichlorobenzyl)-4-nitro-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
Ethyl 1-[(3,4-dichlorophenyl)methyl]-4-nitroindole-2-carboxylate (CAS 220677-29-2) is a chemical compound with the molecular formula C18H14Cl2N2O4 and a molecular weight of 393.2 g/mol. IUPAC name: ethyl 1-[(3,4-dichlorophenyl)methyl]-4-nitroindole-2-carboxylate. InChIKey: KTRMPRXXGFVIEF-UHFFFAOYSA-N.
| Molecular formula | C18H14Cl2N2O4 |
|---|---|
| Molecular weight | 393.2 g/mol |
| IUPAC name | ethyl 1-[(3,4-dichlorophenyl)methyl]-4-nitroindole-2-carboxylate |
| InChIKey | KTRMPRXXGFVIEF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1CC3=CC(=C(C=C3)Cl)Cl)C=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)