Products 2206824-46-4
CAS 2206824-46-4 is the registry number for 5-Phenyl-2,3-dihydro-1H-indole hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
5-phenyl-2,3-dihydro-1H-indole;hydrochloride (CAS 2206824-46-4) is a chemical compound with the molecular formula C14H14ClN and a molecular weight of 231.72 g/mol. IUPAC name: 5-phenyl-2,3-dihydro-1H-indole;hydrochloride. InChIKey: IVFXSSVHHZHPQL-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 5-phenyl-2,3-dihydro-1H-indole;hydrochloride |
| InChIKey | IVFXSSVHHZHPQL-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)