CAS 220725-87-1 is the registry number for EGIS-8332. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-acetyl-5-(4-aminophenyl)-8-methyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-8-carbonitrile (CAS 220725-87-1) is a chemical compound with the molecular formula C20H18N4O3 and a molecular weight of 362.4 g/mol. IUPAC name: 7-acetyl-5-(4-aminophenyl)-8-methyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-8-carbonitrile. InChIKey: CBHCOCUJJQDHSR-UHFFFAOYSA-N.
| Molecular formula | C20H18N4O3 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 7-acetyl-5-(4-aminophenyl)-8-methyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-8-carbonitrile |
| InChIKey | CBHCOCUJJQDHSR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(CC2=CC3=C(C=C2C(=N1)C4=CC=C(C=C4)N)OCO3)(C)C#N |
Computed by PubChem (NCBI)