CAS 220770-41-2 is the registry number for 2,5–Bis(trimethylstannyl)selenophene. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Trimethyl-(5-trimethylstannylselenophen-2-yl)stannane (CAS 220770-41-2) is a chemical compound with the molecular formula C10H20SeSn2 and a molecular weight of 456.7 g/mol. IUPAC name: trimethyl-(5-trimethylstannylselenophen-2-yl)stannane. InChIKey: DTJBEISROOTMQK-UHFFFAOYSA-N.
| Molecular formula | C10H20SeSn2 |
|---|---|
| Molecular weight | 456.7 g/mol |
| IUPAC name | trimethyl-(5-trimethylstannylselenophen-2-yl)stannane |
| InChIKey | DTJBEISROOTMQK-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)C1=CC=C([Se]1)[Sn](C)(C)C |
Computed by PubChem (NCBI)