CAS 220805-22-1 appears in our catalog under these names: NG,NG-Dimethylarginine Dihydrochloride, NG,NG-dimethyl-L-Arginine dihydrochloride/ 99.18% (existing batch purity), NG,NG–dimethyl–L–Arginine (hydrochloride), H-Arg(Me)2-OH 2HCl(asymmetrical) 95%, NG,NG-Dimethyl-L-arginine, D 1PC X 25MG. Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg, 250mg, 5 mg.
(2S)-2-amino-5-[[amino(dimethylamino)methylidene]amino]pentanoic acid;dihydrochloride (CAS 220805-22-1) is a chemical compound with the molecular formula C8H20Cl2N4O2 and a molecular weight of 275.17 g/mol. IUPAC name: (2S)-2-amino-5-[[amino(dimethylamino)methylidene]amino]pentanoic acid;dihydrochloride. InChIKey: SYLNVYJOPZWPJI-ILKKLZGPSA-N.
| Molecular formula | C8H20Cl2N4O2 |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | (2S)-2-amino-5-[[amino(dimethylamino)methylidene]amino]pentanoic acid;dihydrochloride |
| InChIKey | SYLNVYJOPZWPJI-ILKKLZGPSA-N |
| SMILES | CN(C)C(=NCCC[C@@H](C(=O)O)N)N.Cl.Cl |
Computed by PubChem (NCBI)