CAS 220812-15-7 is the registry number for (1R,5R)-6-Oxa-3-azabicyclo[3.1.0]hexan-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5R)-6-oxa-3-azabicyclo[3.1.0]hexan-2-one (CAS 220812-15-7) is a chemical compound with the molecular formula C4H5NO2 and a molecular weight of 99.09 g/mol. IUPAC name: (1R,5R)-6-oxa-3-azabicyclo[3.1.0]hexan-2-one. InChIKey: MVVNSUKLPNNCFD-PWNYCUMCSA-N.
| Molecular formula | C4H5NO2 |
|---|---|
| Molecular weight | 99.09 g/mol |
| IUPAC name | (1R,5R)-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
| InChIKey | MVVNSUKLPNNCFD-PWNYCUMCSA-N |
| SMILES | C1[C@@H]2[C@@H](O2)C(=O)N1 |
Computed by PubChem (NCBI)