CAS 2209-80-5 is the registry number for 2,4,6-Tri(4H-1,2,4-triazol-4-yl)-1,3,5-triazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-tris(1,2,4-triazol-4-yl)-1,3,5-triazine (CAS 2209-80-5) is a chemical compound with the molecular formula C9H6N12 and a molecular weight of 282.23 g/mol. IUPAC name: 2,4,6-tris(1,2,4-triazol-4-yl)-1,3,5-triazine. InChIKey: OOYIZBRQMNFUFK-UHFFFAOYSA-N.
| Molecular formula | C9H6N12 |
|---|---|
| Molecular weight | 282.23 g/mol |
| IUPAC name | 2,4,6-tris(1,2,4-triazol-4-yl)-1,3,5-triazine |
| InChIKey | OOYIZBRQMNFUFK-UHFFFAOYSA-N |
| SMILES | C1=NN=CN1C2=NC(=NC(=N2)N3C=NN=C3)N4C=NN=C4 |
Computed by PubChem (NCBI)