Products 220953-69-5
CAS 220953-69-5 appears in our catalog under these names: Antalarmin hydrochloride, Antalarmin (Hydrochloride), Antalarmin hydrochloride/ 100%, Antalarmin HCl 97%, ANTALARMIN HYDROCHLORIDE. Offered by: GLPBio, TRC, TargetMol, Ambeed, Sigma-Aldrich. Available pack sizes: 5mg, 500mg, 10mg, 25mg, 50mg, 100mg, 1mg, 250mg.
N-butyl-N-ethyl-2,5,6-trimethyl-7-(2,4,6-trimethylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;hydrochloride (CAS 220953-69-5) is a chemical compound with the molecular formula C24H35ClN4 and a molecular weight of 415.0 g/mol. IUPAC name: N-butyl-N-ethyl-2,5,6-trimethyl-7-(2,4,6-trimethylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;hydrochloride. InChIKey: CGDGXEDXEXACKQ-UHFFFAOYSA-N.
| Molecular formula | C24H35ClN4 |
|---|---|
| Molecular weight | 415.0 g/mol |
| IUPAC name | N-butyl-N-ethyl-2,5,6-trimethyl-7-(2,4,6-trimethylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;hydrochloride |
| InChIKey | CGDGXEDXEXACKQ-UHFFFAOYSA-N |
| SMILES | CCCCN(CC)C1=NC(=NC2=C1C(=C(N2C3=C(C=C(C=C3C)C)C)C)C)C.Cl |
Computed by PubChem (NCBI)