CAS 2211054-90-7 appears in our catalog under these names: Macitentan Impurity 2, Macitentan Impurity K. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-[2-(5-bromopyrimidin-2-yl)oxyethoxy]pyrimidine (CAS 2211054-90-7) is a chemical compound with the molecular formula C10H8Br2N4O2 and a molecular weight of 376.00 g/mol. IUPAC name: 5-bromo-2-[2-(5-bromopyrimidin-2-yl)oxyethoxy]pyrimidine. InChIKey: ITCWLFQPBZOBCV-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2N4O2 |
|---|---|
| Molecular weight | 376.00 g/mol |
| IUPAC name | 5-bromo-2-[2-(5-bromopyrimidin-2-yl)oxyethoxy]pyrimidine |
| InChIKey | ITCWLFQPBZOBCV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)OCCOC2=NC=C(C=N2)Br)Br |
Computed by PubChem (NCBI)