Products 2211060-61-4
CAS 2211060-61-4 is the registry number for Antifungal agent 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(5,7-dibromoquinolin-8-yl)oxymethyl]-4-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one (CAS 2211060-61-4) is a chemical compound with the molecular formula C19H11Br2F3N4O2 and a molecular weight of 544.1 g/mol. IUPAC name: 3-[(5,7-dibromoquinolin-8-yl)oxymethyl]-4-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one. InChIKey: WWPNEOCKKAGAFC-UHFFFAOYSA-N.
| Molecular formula | C19H11Br2F3N4O2 |
|---|---|
| Molecular weight | 544.1 g/mol |
| IUPAC name | 3-[(5,7-dibromoquinolin-8-yl)oxymethyl]-4-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one |
| InChIKey | WWPNEOCKKAGAFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2Br)Br)OCC3=NNC(=O)N3C4=CC=C(C=C4)C(F)(F)F)N=C1 |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 2, orb1710416