CAS 2211082-53-8 appears in our catalog under these names: Gunagratinib, 98%, Gunagratinib, Gunagratinib 98%, gunagratinib, 99%, 99%, Gunagratinib, 98.52%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 1mg, 25mg, 50 mg, 100 mg, 25 mg.
3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-(methylamino)-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide (CAS 2211082-53-8) is a chemical compound with the molecular formula C22H25N5O4 and a molecular weight of 423.5 g/mol. IUPAC name: 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-(methylamino)-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide. InChIKey: QFUIJOBJAQBGDH-HNNXBMFYSA-N.
| Molecular formula | C22H25N5O4 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-(methylamino)-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide |
| InChIKey | QFUIJOBJAQBGDH-HNNXBMFYSA-N |
| SMILES | CNC1=C(C(=NN1[C@H]2CCN(C2)C(=O)C=C)C#CC3=CC(=CC(=C3)OC)OC)C(=O)N |
Computed by PubChem (NCBI)