CAS 22112-89-6 appears in our catalog under these names: 5,15-Diphenyl-21h,23h-porphine, 95%, 5,15-DPP, 5,15–DPP, 5,15-Diphenylporphyrin, >90.0%(HPLC), 5,15-Diphenylporphyrin 90%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 250mg, 1g, 5mg, 10mg, 100mg, 25mg, 50mg, 5g.
10,20-diphenyl-21,22-dihydroporphyrin (CAS 22112-89-6) is a chemical compound with the molecular formula C32H22N4 and a molecular weight of 462.5 g/mol. IUPAC name: 10,20-diphenyl-21,22-dihydroporphyrin. InChIKey: QIBKIAFNCVIIMG-UHFFFAOYSA-N.
| Molecular formula | C32H22N4 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | 10,20-diphenyl-21,22-dihydroporphyrin |
| InChIKey | QIBKIAFNCVIIMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=CC4=CC=C(N4)C(=C5C=CC(=N5)C=C6C=CC2=N6)C7=CC=CC=C7)N3 |
Computed by PubChem (NCBI)