Products 221144-20-3
CAS 221144-20-3 is the registry number for NC 2300. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium (2S,3S)-3-[[(2S)-4-methyl-1-(2-methylpropoxy)pentan-2-yl]carbamoyl]oxirane-2-carboxylate (CAS 221144-20-3) is a chemical compound with the molecular formula C14H24NNaO5 and a molecular weight of 309.33 g/mol. IUPAC name: sodium (2S,3S)-3-[[(2S)-4-methyl-1-(2-methylpropoxy)pentan-2-yl]carbamoyl]oxirane-2-carboxylate. InChIKey: SGAKODIXAHVUKL-LFELFHSZSA-M.
| Molecular formula | C14H24NNaO5 |
|---|---|
| Molecular weight | 309.33 g/mol |
| IUPAC name | sodium (2S,3S)-3-[[(2S)-4-methyl-1-(2-methylpropoxy)pentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| InChIKey | SGAKODIXAHVUKL-LFELFHSZSA-M |
| SMILES | CC(C)C[C@@H](COCC(C)C)NC(=O)[C@@H]1[C@H](O1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)