CAS 221148-37-4 is the registry number for 1-(2,2-Dibromoethenyl)-3-fluoro-benzene, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2,2-dibromoethenyl)-3-fluorobenzene (CAS 221148-37-4) is a chemical compound with the molecular formula C8H5Br2F and a molecular weight of 279.93 g/mol. IUPAC name: 1-(2,2-dibromoethenyl)-3-fluorobenzene. InChIKey: WEKYBTNENFEUME-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F |
|---|---|
| Molecular weight | 279.93 g/mol |
| IUPAC name | 1-(2,2-dibromoethenyl)-3-fluorobenzene |
| InChIKey | WEKYBTNENFEUME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C=C(Br)Br |
Computed by PubChem (NCBI)