CAS 2211997-41-8 is the registry number for M-TETPO, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
1-[(2,2,5,5-tetraethyl-1-oxidopyrrol-3-yl)methyl]pyrrole-2,5-dione (CAS 2211997-41-8) is a chemical compound with the molecular formula C17H25N2O3- and a molecular weight of 305.4 g/mol. IUPAC name: 1-[(2,2,5,5-tetraethyl-1-oxidopyrrol-3-yl)methyl]pyrrole-2,5-dione. InChIKey: UQOWSODFYBHSCC-UHFFFAOYSA-N.
| Molecular formula | C17H25N2O3- |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 1-[(2,2,5,5-tetraethyl-1-oxidopyrrol-3-yl)methyl]pyrrole-2,5-dione |
| InChIKey | UQOWSODFYBHSCC-UHFFFAOYSA-N |
| SMILES | CCC1(C=C(C(N1[O-])(CC)CC)CN2C(=O)C=CC2=O)CC |
Computed by PubChem (NCBI)