CAS 2212-35-3 appears in our catalog under these names: N1-(2-(Benzhydryloxy)ethyl)-N1,N2,N2-trimethylethane-1,2-diamine, 98%, Dimenhydrinate EP Impurity D, Dimenhydrinate Impurity 4 (Dimenhydrinate EP Impurity D), Dimenhydrinate EP Impurity D DiHCl. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N'-(2-benzhydryloxyethyl)-N,N,N'-trimethylethane-1,2-diamine (CAS 2212-35-3) is a chemical compound with the molecular formula C20H28N2O and a molecular weight of 312.4 g/mol. IUPAC name: N'-(2-benzhydryloxyethyl)-N,N,N'-trimethylethane-1,2-diamine. InChIKey: BLQCBHWUCVDSIF-UHFFFAOYSA-N.
| Molecular formula | C20H28N2O |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | N'-(2-benzhydryloxyethyl)-N,N,N'-trimethylethane-1,2-diamine |
| InChIKey | BLQCBHWUCVDSIF-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)