CAS 2212-50-2 is the registry number for 4-(1-Ethyldecyl)benzenesulfonic Acid Sodium Salt. Offered by: TRC. Available pack sizes: 2,5g.
Sodium 4-dodecan-3-ylbenzenesulfonate (CAS 2212-50-2) is a chemical compound with the molecular formula C18H29NaO3S and a molecular weight of 348.5 g/mol. IUPAC name: sodium 4-dodecan-3-ylbenzenesulfonate. InChIKey: HOXWFOVSCUWIEH-UHFFFAOYSA-M.
| Molecular formula | C18H29NaO3S |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | sodium 4-dodecan-3-ylbenzenesulfonate |
| InChIKey | HOXWFOVSCUWIEH-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC(CC)C1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)