Products 2212005-41-7
CAS 2212005-41-7 is the registry number for 2,6-Bis(1-(3,5-dimethylphenyl)vinyl)-4-methylaniline. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-bis[1-(3,5-dimethylphenyl)ethenyl]-4-methylaniline (CAS 2212005-41-7) is a chemical compound with the molecular formula C27H29N and a molecular weight of 367.5 g/mol. IUPAC name: 2,6-bis[1-(3,5-dimethylphenyl)ethenyl]-4-methylaniline. InChIKey: GUDUGXYIBQZWQV-UHFFFAOYSA-N.
| Molecular formula | C27H29N |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | 2,6-bis[1-(3,5-dimethylphenyl)ethenyl]-4-methylaniline |
| InChIKey | GUDUGXYIBQZWQV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=C)C2=CC(=CC(=C2N)C(=C)C3=CC(=CC(=C3)C)C)C)C |
Computed by PubChem (NCBI)