Products 2212021-55-9
CAS 2212021-55-9 is the registry number for Di-tert-butyl 1-(4-fluoro-3,5-dimethylphenyl)hydrazine-1,2-dicarboxylate, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl N-(4-fluoro-3,5-dimethylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (CAS 2212021-55-9) is a chemical compound with the molecular formula C18H27FN2O4 and a molecular weight of 354.4 g/mol. IUPAC name: tert-butyl N-(4-fluoro-3,5-dimethylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate. InChIKey: ACEVGWLCWPYSAO-UHFFFAOYSA-N.
| Molecular formula | C18H27FN2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | tert-butyl N-(4-fluoro-3,5-dimethylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| InChIKey | ACEVGWLCWPYSAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C)N(C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)