Products 221221-18-7
CAS 221221-18-7 is the registry number for PGE 9262932. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(3R)-3-[(1S)-1-aminoethyl]pyrrolidin-1-yl]-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylic acid (CAS 221221-18-7) is a chemical compound with the molecular formula C20H25N3O4 and a molecular weight of 371.4 g/mol. IUPAC name: 7-[(3R)-3-[(1S)-1-aminoethyl]pyrrolidin-1-yl]-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylic acid. InChIKey: QZNDHGLQSLWHRB-NWDGAFQWSA-N.
| Molecular formula | C20H25N3O4 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 7-[(3R)-3-[(1S)-1-aminoethyl]pyrrolidin-1-yl]-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| InChIKey | QZNDHGLQSLWHRB-NWDGAFQWSA-N |
| SMILES | C[C@@H]([C@@H]1CCN(C1)C2=C(C3=C(C=C2)C(=O)C(=CN3C4CC4)C(=O)O)OC)N |
Computed by PubChem (NCBI)