Products 2879250-22-1
CAS 2879250-22-1 is the registry number for WIZ degrader 4, 99.37%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 5 mg, 10mM/1mL, 10 mg.
3-[6-[(3R)-1-ethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2879250-22-1) is a chemical compound with the molecular formula C20H25N3O4 and a molecular weight of 371.4 g/mol. IUPAC name: 3-[6-[(3R)-1-ethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: VGRDATXDONRIRI-LDCVWXEPSA-N.
| Molecular formula | C20H25N3O4 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 3-[6-[(3R)-1-ethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | VGRDATXDONRIRI-LDCVWXEPSA-N |
| SMILES | CCN1CCC[C@H](C1)OC2=CC3=C(C=C2)C(=O)N(C3)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)
Synonyms:
WIZ degrader 4, orb2664454