CAS 221222-49-7 appears in our catalog under these names: 32-Mercapto-3,6,9,12,15,18,21-heptaoxadotriacontan-1-oic acid, 97%, Tricosanoic Acid Impurity 6, 23-(9-Mercaptononyl)-3,6,9,12,15,18,21-heptaoxatricosanoic Acid (>85%), >95% (HPLC), Carboxy-EG6-undecanethiol. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg, 100 mg.
2-[2-[2-[2-[2-[2-[2-(11-sulfanylundecoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 221222-49-7) is a chemical compound with the molecular formula C25H50O9S and a molecular weight of 526.7 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(11-sulfanylundecoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: XMVZGUSQWSVPNT-UHFFFAOYSA-N.
| Molecular formula | C25H50O9S |
|---|---|
| Molecular weight | 526.7 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(11-sulfanylundecoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | XMVZGUSQWSVPNT-UHFFFAOYSA-N |
| SMILES | C(CCCCCOCCOCCOCCOCCOCCOCCOCC(=O)O)CCCCCS |
Computed by PubChem (NCBI)